C20H23NO3S — CID 7638596
(4-methylphenyl)methyl 2-[2-oxo-2-(propan-2-ylamino)ethyl]sulfanylbenzoate (PubChem CID 7638596) has the molecular formula C20H23NO3S and a molecular weight of 357.48 g/mol. Its IUPAC name is (4-methylphenyl)methyl 2-[2-oxo-2-(propan-2-ylamino)ethyl]sulfanylbenzoate.
| Compound Name | (4-methylphenyl)methyl 2-[2-oxo-2-(propan-2-ylamino)ethyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 7638596 |
| Molecular Formula | C20H23NO3S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | (4-methylphenyl)methyl 2-[2-oxo-2-(propan-2-ylamino)ethyl]sulfanylbenzoate |
| SMILES | Cc1ccc(COC(=O)c2ccccc2SCC(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C20H23NO3S/c1-14(2)21-19(22)13-25-18-7-5-4-6-17(18)20(23)24-12-16-10-8-15(3)9-11-16/h4-11,14H,12-13H2,1-3H3,(H,21,22) |
| InChIKey | JDCFLOJYGWZMPZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |