C20H26N2O4S — CID 7209185
[2-(cyclopentylamino)-2-oxoethyl] 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzoate (PubChem CID 7209185) has the molecular formula C20H26N2O4S and a molecular weight of 390.51 g/mol. Its IUPAC name is [2-(cyclopentylamino)-2-oxoethyl] 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzoate.
| Compound Name | [2-(cyclopentylamino)-2-oxoethyl] 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzoate |
|---|---|
| PubChem CID | 7209185 |
| Molecular Formula | C20H26N2O4S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | [2-(cyclopentylamino)-2-oxoethyl] 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzoate |
| SMILES | O=C(COC(=O)c1ccccc1SCC(=O)N1CCCC1)NC1CCCC1 |
| InChI | InChI=1S/C20H26N2O4S/c23-18(21-15-7-1-2-8-15)13-26-20(25)16-9-3-4-10-17(16)27-14-19(24)22-11-5-6-12-22/h3-4,9-10,15H,1-2,5-8,11-14H2,(H,21,23) |
| InChIKey | JBYUGEJVQHMUBZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |