C21H21IN2O4S — CID 16502259
[2-(2-iodoanilino)-2-oxoethyl] 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzoate (PubChem CID 16502259) has the molecular formula C21H21IN2O4S and a molecular weight of 524.38 g/mol. Its IUPAC name is [2-(2-iodoanilino)-2-oxoethyl] 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzoate.
| Compound Name | [2-(2-iodoanilino)-2-oxoethyl] 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzoate |
|---|---|
| PubChem CID | 16502259 |
| Molecular Formula | C21H21IN2O4S |
| Molecular Weight | 524.38 g/mol |
| Exact Mass | 524.03 |
| IUPAC Name | [2-(2-iodoanilino)-2-oxoethyl] 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzoate |
| SMILES | O=C(COC(=O)c1ccccc1SCC(=O)N1CCCC1)Nc1ccccc1I |
| InChI | InChI=1S/C21H21IN2O4S/c22-16-8-2-3-9-17(16)23-19(25)13-28-21(27)15-7-1-4-10-18(15)29-14-20(26)24-11-5-6-12-24/h1-4,7-10H,5-6,11-14H2,(H,23,25) |
| InChIKey | RIYGTKLPXKMTNJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|