C15H18N2O4S — CID 2648719
(2-amino-2-oxoethyl) 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzoate (PubChem CID 2648719) has the molecular formula C15H18N2O4S and a molecular weight of 322.39 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzoate.
| Compound Name | (2-amino-2-oxoethyl) 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzoate |
|---|---|
| PubChem CID | 2648719 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | (2-amino-2-oxoethyl) 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzoate |
| SMILES | NC(=O)COC(=O)c1ccccc1SCC(=O)N1CCCC1 |
| InChI | InChI=1S/C15H18N2O4S/c16-13(18)9-21-15(20)11-5-1-2-6-12(11)22-10-14(19)17-7-3-4-8-17/h1-2,5-6H,3-4,7-10H2,(H2,16,18) |
| InChIKey | FHYDLSOGDDBMJN-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |