C25H32N2O4S — CID 16502283
[2-(1-adamantylamino)-2-oxoethyl] 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzoate (PubChem CID 16502283) has the molecular formula C25H32N2O4S and a molecular weight of 456.61 g/mol. Its IUPAC name is [2-(1-adamantylamino)-2-oxoethyl] 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzoate.
| Compound Name | [2-(1-adamantylamino)-2-oxoethyl] 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzoate |
|---|---|
| PubChem CID | 16502283 |
| Molecular Formula | C25H32N2O4S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | [2-(1-adamantylamino)-2-oxoethyl] 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzoate |
| SMILES | O=C(COC(=O)c1ccccc1SCC(=O)N1CCCC1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H32N2O4S/c28-22(26-25-12-17-9-18(13-25)11-19(10-17)14-25)15-31-24(30)20-5-1-2-6-21(20)32-16-23(29)27-7-3-4-8-27/h1-2,5-6,17-19H,3-4,7-16H2,(H,26,28) |
| InChIKey | YJIJCAWJBDHTAK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |