C27H34N2O4S — CID 16502187
[2-[bis(prop-2-enyl)amino]-2-oxoethyl] 2-[2-(1-adamantylamino)-2-oxoethyl]sulfanylbenzoate (PubChem CID 16502187) has the molecular formula C27H34N2O4S and a molecular weight of 482.65 g/mol. Its IUPAC name is [2-[bis(prop-2-enyl)amino]-2-oxoethyl] 2-[2-(1-adamantylamino)-2-oxoethyl]sulfanylbenzoate.
| Compound Name | [2-[bis(prop-2-enyl)amino]-2-oxoethyl] 2-[2-(1-adamantylamino)-2-oxoethyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 16502187 |
| Molecular Formula | C27H34N2O4S |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | [2-[bis(prop-2-enyl)amino]-2-oxoethyl] 2-[2-(1-adamantylamino)-2-oxoethyl]sulfanylbenzoate |
| SMILES | C=CCN(CC=C)C(=O)COC(=O)c1ccccc1SCC(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H34N2O4S/c1-3-9-29(10-4-2)25(31)17-33-26(32)22-7-5-6-8-23(22)34-18-24(30)28-27-14-19-11-20(15-27)13-21(12-19)16-27/h3-8,19-21H,1-2,9-18H2,(H,28,30) |
| InChIKey | VBPBKWPKFOQTKY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|