C28H34N2O2S — CID 41113839
2-[2-(1-adamantylamino)-2-oxoethyl]sulfanyl-N-[(2S)-2-phenylpropyl]benzamide (PubChem CID 41113839) has the molecular formula C28H34N2O2S and a molecular weight of 462.66 g/mol. Its IUPAC name is 2-[2-(1-adamantylamino)-2-oxoethyl]sulfanyl-N-[(2S)-2-phenylpropyl]benzamide.
| Compound Name | 2-[2-(1-adamantylamino)-2-oxoethyl]sulfanyl-N-[(2S)-2-phenylpropyl]benzamide |
|---|---|
| PubChem CID | 41113839 |
| Molecular Formula | C28H34N2O2S |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 2-[2-(1-adamantylamino)-2-oxoethyl]sulfanyl-N-[(2S)-2-phenylpropyl]benzamide |
| SMILES | C[C@H](CNC(=O)c1ccccc1SCC(=O)NC12CC3CC(CC(C3)C1)C2)c1ccccc1 |
| InChI | InChI=1S/C28H34N2O2S/c1-19(23-7-3-2-4-8-23)17-29-27(32)24-9-5-6-10-25(24)33-18-26(31)30-28-14-20-11-21(15-28)13-22(12-20)16-28/h2-10,19-22H,11-18H2,1H3,(H,29,32)(H,30,31)/t19-,20?,21?,22?,28?/m1/s1 |
| InChIKey | NCLGXEBNHKPAEB-AOXVDABRSA-N |
| XLogP | 5.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |