C27H32N2O2S — CID 26409410
2-[2-(1-adamantylamino)-2-oxoethyl]sulfanyl-N-(3,5-dimethylphenyl)benzamide (PubChem CID 26409410) has the molecular formula C27H32N2O2S and a molecular weight of 448.63 g/mol. Its IUPAC name is 2-[2-(1-adamantylamino)-2-oxoethyl]sulfanyl-N-(3,5-dimethylphenyl)benzamide.
| Compound Name | 2-[2-(1-adamantylamino)-2-oxoethyl]sulfanyl-N-(3,5-dimethylphenyl)benzamide |
|---|---|
| PubChem CID | 26409410 |
| Molecular Formula | C27H32N2O2S |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 2-[2-(1-adamantylamino)-2-oxoethyl]sulfanyl-N-(3,5-dimethylphenyl)benzamide |
| SMILES | Cc1cc(C)cc(NC(=O)c2ccccc2SCC(=O)NC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C27H32N2O2S/c1-17-7-18(2)9-22(8-17)28-26(31)23-5-3-4-6-24(23)32-16-25(30)29-27-13-19-10-20(14-27)12-21(11-19)15-27/h3-9,19-21H,10-16H2,1-2H3,(H,28,31)(H,29,30) |
| InChIKey | QLIHNEOKTBJRAW-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |