C27H32N2O2S — CID 112760151
2-[2-(1-adamantylamino)-2-oxoethyl]sulfanyl-N-benzyl-N-methylbenzamide (PubChem CID 112760151) has the molecular formula C27H32N2O2S and a molecular weight of 448.63 g/mol. Its IUPAC name is 2-[2-(1-adamantylamino)-2-oxoethyl]sulfanyl-N-benzyl-N-methylbenzamide.
| Compound Name | 2-[2-(1-adamantylamino)-2-oxoethyl]sulfanyl-N-benzyl-N-methylbenzamide |
|---|---|
| PubChem CID | 112760151 |
| Molecular Formula | C27H32N2O2S |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 2-[2-(1-adamantylamino)-2-oxoethyl]sulfanyl-N-benzyl-N-methylbenzamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1ccccc1SCC(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H32N2O2S/c1-29(17-19-7-3-2-4-8-19)26(31)23-9-5-6-10-24(23)32-18-25(30)28-27-14-20-11-21(15-27)13-22(12-20)16-27/h2-10,20-22H,11-18H2,1H3,(H,28,30) |
| InChIKey | QPTSRCKWFCRFNP-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |