C27H31FN2O2S — CID 55332495
2-[2-(1-adamantylamino)-2-oxoethyl]sulfanyl-N-[(4-fluorophenyl)methyl]-N-methylbenzamide (PubChem CID 55332495) has the molecular formula C27H31FN2O2S and a molecular weight of 466.62 g/mol. Its IUPAC name is 2-[2-(1-adamantylamino)-2-oxoethyl]sulfanyl-N-[(4-fluorophenyl)methyl]-N-methylbenzamide.
| Compound Name | 2-[2-(1-adamantylamino)-2-oxoethyl]sulfanyl-N-[(4-fluorophenyl)methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 55332495 |
| Molecular Formula | C27H31FN2O2S |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 2-[2-(1-adamantylamino)-2-oxoethyl]sulfanyl-N-[(4-fluorophenyl)methyl]-N-methylbenzamide |
| SMILES | CN(Cc1ccc(F)cc1)C(=O)c1ccccc1SCC(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H31FN2O2S/c1-30(16-18-6-8-22(28)9-7-18)26(32)23-4-2-3-5-24(23)33-17-25(31)29-27-13-19-10-20(14-27)12-21(11-19)15-27/h2-9,19-21H,10-17H2,1H3,(H,29,31) |
| InChIKey | PYTGTNQWNMYVJM-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |