C27H30N2O4S — CID 55641802
(3-carbamoylphenyl)methyl 2-[2-(1-adamantylamino)-2-oxoethyl]sulfanylbenzoate (PubChem CID 55641802) has the molecular formula C27H30N2O4S and a molecular weight of 478.61 g/mol. Its IUPAC name is (3-carbamoylphenyl)methyl 2-[2-(1-adamantylamino)-2-oxoethyl]sulfanylbenzoate.
| Compound Name | (3-carbamoylphenyl)methyl 2-[2-(1-adamantylamino)-2-oxoethyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 55641802 |
| Molecular Formula | C27H30N2O4S |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | (3-carbamoylphenyl)methyl 2-[2-(1-adamantylamino)-2-oxoethyl]sulfanylbenzoate |
| SMILES | NC(=O)c1cccc(COC(=O)c2ccccc2SCC(=O)NC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C27H30N2O4S/c28-25(31)21-5-3-4-17(11-21)15-33-26(32)22-6-1-2-7-23(22)34-16-24(30)29-27-12-18-8-19(13-27)10-20(9-18)14-27/h1-7,11,18-20H,8-10,12-16H2,(H2,28,31)(H,29,30) |
| InChIKey | OVVFMZJJPXWLIF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |