C29H30N2O4S — CID 16502182
[2-(1H-indol-3-yl)-2-oxoethyl] 2-[2-(1-adamantylamino)-2-oxoethyl]sulfanylbenzoate (PubChem CID 16502182) has the molecular formula C29H30N2O4S and a molecular weight of 502.64 g/mol. Its IUPAC name is [2-(1H-indol-3-yl)-2-oxoethyl] 2-[2-(1-adamantylamino)-2-oxoethyl]sulfanylbenzoate.
| Compound Name | [2-(1H-indol-3-yl)-2-oxoethyl] 2-[2-(1-adamantylamino)-2-oxoethyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 16502182 |
| Molecular Formula | C29H30N2O4S |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | [2-(1H-indol-3-yl)-2-oxoethyl] 2-[2-(1-adamantylamino)-2-oxoethyl]sulfanylbenzoate |
| SMILES | O=C(CSc1ccccc1C(=O)OCC(=O)c1c[nH]c2ccccc12)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C29H30N2O4S/c32-25(23-15-30-24-7-3-1-5-21(23)24)16-35-28(34)22-6-2-4-8-26(22)36-17-27(33)31-29-12-18-9-19(13-29)11-20(10-18)14-29/h1-8,15,18-20,30H,9-14,16-17H2,(H,31,33) |
| InChIKey | BCXGXSQEJKCQEO-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |