C23H21N3O3S — CID 16616439
(1-cyanoindolizin-2-yl)methyl 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzoate (PubChem CID 16616439) has the molecular formula C23H21N3O3S and a molecular weight of 419.51 g/mol. Its IUPAC name is (1-cyanoindolizin-2-yl)methyl 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzoate.
| Compound Name | (1-cyanoindolizin-2-yl)methyl 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzoate |
|---|---|
| PubChem CID | 16616439 |
| Molecular Formula | C23H21N3O3S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | (1-cyanoindolizin-2-yl)methyl 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzoate |
| SMILES | N#Cc1c(COC(=O)c2ccccc2SCC(=O)N2CCCC2)cn2ccccc12 |
| InChI | InChI=1S/C23H21N3O3S/c24-13-19-17(14-26-12-4-3-8-20(19)26)15-29-23(28)18-7-1-2-9-21(18)30-16-22(27)25-10-5-6-11-25/h1-4,7-9,12,14H,5-6,10-11,15-16H2 |
| InChIKey | NHORZGIFMNOILH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 74.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |