C15H13F3N2O2 — CID 166189729
[3-(trifluoromethyl)phenyl]methyl 4-ethylpyrimidine-5-carboxylate (PubChem CID 166189729) has the molecular formula C15H13F3N2O2 and a molecular weight of 310.28 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl]methyl 4-ethylpyrimidine-5-carboxylate.
| Compound Name | [3-(trifluoromethyl)phenyl]methyl 4-ethylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 166189729 |
| Molecular Formula | C15H13F3N2O2 |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | [3-(trifluoromethyl)phenyl]methyl 4-ethylpyrimidine-5-carboxylate |
| SMILES | CCc1ncncc1C(=O)OCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H13F3N2O2/c1-2-13-12(7-19-9-20-13)14(21)22-8-10-4-3-5-11(6-10)15(16,17)18/h3-7,9H,2,8H2,1H3 |
| InChIKey | UVVNXZUWSPFFGV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |