C13H10F3NO2S — CID 61315831
[3-(trifluoromethyl)phenyl]methyl 3-aminothiophene-2-carboxylate (PubChem CID 61315831) has the molecular formula C13H10F3NO2S and a molecular weight of 301.29 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl]methyl 3-aminothiophene-2-carboxylate.
| Compound Name | [3-(trifluoromethyl)phenyl]methyl 3-aminothiophene-2-carboxylate |
|---|---|
| PubChem CID | 61315831 |
| Molecular Formula | C13H10F3NO2S |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | [3-(trifluoromethyl)phenyl]methyl 3-aminothiophene-2-carboxylate |
| SMILES | Nc1ccsc1C(=O)OCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H10F3NO2S/c14-13(15,16)9-3-1-2-8(6-9)7-19-12(18)11-10(17)4-5-20-11/h1-6H,7,17H2 |
| InChIKey | ZKHFCOZWJSCIPL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |