C15H12F3NO2S — CID 3545378
[3-(trifluoromethyl)phenyl]methyl 2-methylsulfanylpyridine-3-carboxylate (PubChem CID 3545378) has the molecular formula C15H12F3NO2S and a molecular weight of 327.33 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl]methyl 2-methylsulfanylpyridine-3-carboxylate.
| Compound Name | [3-(trifluoromethyl)phenyl]methyl 2-methylsulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 3545378 |
| Molecular Formula | C15H12F3NO2S |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | [3-(trifluoromethyl)phenyl]methyl 2-methylsulfanylpyridine-3-carboxylate |
| SMILES | CSc1ncccc1C(=O)OCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H12F3NO2S/c1-22-13-12(6-3-7-19-13)14(20)21-9-10-4-2-5-11(8-10)15(16,17)18/h2-8H,9H2,1H3 |
| InChIKey | FTKLTBBCORIHRY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |