About 2-phenylmethoxyethyl 4-ethylpyrimidine-5-carboxylate
2-phenylmethoxyethyl 4-ethylpyrimidine-5-carboxylate (PubChem CID 71874314) has the molecular formula C16H18N2O3
and a molecular weight of 286.33 g/mol. Its IUPAC name is 2-phenylmethoxyethyl 4-ethylpyrimidine-5-carboxylate.
Molecular Properties
| Compound Name | 2-phenylmethoxyethyl 4-ethylpyrimidine-5-carboxylate |
| PubChem CID | 71874314 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 2-phenylmethoxyethyl 4-ethylpyrimidine-5-carboxylate |
| SMILES | CCc1ncncc1C(=O)OCCOCc1ccccc1 |
| InChI | InChI=1S/C16H18N2O3/c1-2-15-14(10-17-12-18-15)16(19)21-9-8-20-11-13-6-4-3-5-7-13/h3-7,10,12H,2,8-9,11H2,1H3 |
| InChIKey | ZMRSJKKLFAGMRD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylmethoxyethyl 4-ethylpyrimidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylmethoxyethyl 4-ethylpyrimidine-5-carboxylate?
The IUPAC name of 2-phenylmethoxyethyl 4-ethylpyrimidine-5-carboxylate (CID 71874314) is 2-phenylmethoxyethyl 4-ethylpyrimidine-5-carboxylate.
What is the SMILES notation for 2-phenylmethoxyethyl 4-ethylpyrimidine-5-carboxylate?
The canonical SMILES for 2-phenylmethoxyethyl 4-ethylpyrimidine-5-carboxylate is CCc1ncncc1C(=O)OCCOCc1ccccc1.
What is the InChIKey of 2-phenylmethoxyethyl 4-ethylpyrimidine-5-carboxylate?
The InChIKey is ZMRSJKKLFAGMRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O3/c1-2-15-14(10-17-12-18-15)16(19)21-9-8-20-11-13-6-4-3-5-7-13/h3-7,10,12H,2,8-9,11H2,1H3.
What are the key properties of 2-phenylmethoxyethyl 4-ethylpyrimidine-5-carboxylate?
2-phenylmethoxyethyl 4-ethylpyrimidine-5-carboxylate has a molecular weight of 286.33 g/mol, XLogP of 2.41, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylmethoxyethyl 4-ethylpyrimidine-5-carboxylate is sourced from PubChem (CID 71874314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).