C19H17ClF3NO5S — CID 3649598
[3-(trifluoromethyl)phenyl]methyl 2-chloro-5-morpholin-4-ylsulfonylbenzoate (PubChem CID 3649598) has the molecular formula C19H17ClF3NO5S and a molecular weight of 463.86 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl]methyl 2-chloro-5-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [3-(trifluoromethyl)phenyl]methyl 2-chloro-5-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 3649598 |
| Molecular Formula | C19H17ClF3NO5S |
| Molecular Weight | 463.86 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | [3-(trifluoromethyl)phenyl]methyl 2-chloro-5-morpholin-4-ylsulfonylbenzoate |
| SMILES | O=C(OCc1cccc(C(F)(F)F)c1)c1cc(S(=O)(=O)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C19H17ClF3NO5S/c20-17-5-4-15(30(26,27)24-6-8-28-9-7-24)11-16(17)18(25)29-12-13-2-1-3-14(10-13)19(21,22)23/h1-5,10-11H,6-9,12H2 |
| InChIKey | XVALEUJMCXWGPS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.86 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |