About [3-(trifluoromethyl)phenyl]methyl 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzoate
[3-(trifluoromethyl)phenyl]methyl 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzoate (PubChem CID 3574078) has the molecular formula C24H20F3NO4S
and a molecular weight of 475.49 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl]methyl 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzoate.
Molecular Properties
| Compound Name | [3-(trifluoromethyl)phenyl]methyl 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzoate |
| PubChem CID | 3574078 |
| Molecular Formula | C24H20F3NO4S |
| Molecular Weight | 475.49 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | [3-(trifluoromethyl)phenyl]methyl 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzoate |
| SMILES | O=C(OCc1cccc(C(F)(F)F)c1)c1cccc(S(=O)(=O)N2CCc3ccccc3C2)c1 |
| InChI | InChI=1S/C24H20F3NO4S/c25-24(26,27)21-9-3-5-17(13-21)16-32-23(29)19-8-4-10-22(14-19)33(30,31)28-12-11-18-6-1-2-7-20(18)15-28/h1-10,13-14H,11-12,15-16H2 |
| InChIKey | ROLWEGPABQMRQD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 475.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(trifluoromethyl)phenyl]methyl 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(trifluoromethyl)phenyl]methyl 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzoate?
The IUPAC name of [3-(trifluoromethyl)phenyl]methyl 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzoate (CID 3574078) is [3-(trifluoromethyl)phenyl]methyl 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzoate.
What is the SMILES notation for [3-(trifluoromethyl)phenyl]methyl 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzoate?
The canonical SMILES for [3-(trifluoromethyl)phenyl]methyl 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzoate is O=C(OCc1cccc(C(F)(F)F)c1)c1cccc(S(=O)(=O)N2CCc3ccccc3C2)c1.
What is the InChIKey of [3-(trifluoromethyl)phenyl]methyl 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzoate?
The InChIKey is ROLWEGPABQMRQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20F3NO4S/c25-24(26,27)21-9-3-5-17(13-21)16-32-23(29)19-8-4-10-22(14-19)33(30,31)28-12-11-18-6-1-2-7-20(18)15-28/h1-10,13-14H,11-12,15-16H2.
What are the key properties of [3-(trifluoromethyl)phenyl]methyl 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzoate?
[3-(trifluoromethyl)phenyl]methyl 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzoate has a molecular weight of 475.49 g/mol, XLogP of 4.81, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(trifluoromethyl)phenyl]methyl 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzoate is sourced from PubChem (CID 3574078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).