C25H22N2O6S — CID 35832115
(2-benzamido-2-oxoethyl) 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzoate (PubChem CID 35832115) has the molecular formula C25H22N2O6S and a molecular weight of 478.53 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzoate.
| Compound Name | (2-benzamido-2-oxoethyl) 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 35832115 |
| Molecular Formula | C25H22N2O6S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | (2-benzamido-2-oxoethyl) 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzoate |
| SMILES | O=C(COC(=O)c1cccc(S(=O)(=O)N2CCc3ccccc3C2)c1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H22N2O6S/c28-23(26-24(29)19-8-2-1-3-9-19)17-33-25(30)20-11-6-12-22(15-20)34(31,32)27-14-13-18-7-4-5-10-21(18)16-27/h1-12,15H,13-14,16-17H2,(H,26,28,29) |
| InChIKey | APVHXJPGOWQDQC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |