C21H17Cl3N4OS — CID 66690619
N'-[2-chloro-4-[[4-cyano-3-(2,4-dichlorophenyl)-1,2-thiazol-5-yl]oxy]-5-methylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 66690619) has the molecular formula C21H17Cl3N4OS and a molecular weight of 479.82 g/mol. Its IUPAC name is N'-[2-chloro-4-[[4-cyano-3-(2,4-dichlorophenyl)-1,2-thiazol-5-yl]oxy]-5-methylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2-chloro-4-[[4-cyano-3-(2,4-dichlorophenyl)-1,2-thiazol-5-yl]oxy]-5-methylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 66690619 |
| Molecular Formula | C21H17Cl3N4OS |
| Molecular Weight | 479.82 g/mol |
| Exact Mass | 478.02 |
| IUPAC Name | N'-[2-chloro-4-[[4-cyano-3-(2,4-dichlorophenyl)-1,2-thiazol-5-yl]oxy]-5-methylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(Oc2snc(-c3ccc(Cl)cc3Cl)c2C#N)cc1Cl |
| InChI | InChI=1S/C21H17Cl3N4OS/c1-4-28(3)11-26-18-7-12(2)19(9-17(18)24)29-21-15(10-25)20(27-30-21)14-6-5-13(22)8-16(14)23/h5-9,11H,4H2,1-3H3/b26-11+ |
| InChIKey | JPCMUILNOPNKCW-KBKYJPHKSA-N |
| XLogP | 7.35 |
| TPSA | 61.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.82 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|