C20H25N3O — CID 150769189
N-ethyl-N'-[7-(2-methoxyanilino)-2,3-dihydro-1H-inden-4-yl]-N-methylmethanimidamide (PubChem CID 150769189) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is N-ethyl-N'-[7-(2-methoxyanilino)-2,3-dihydro-1H-inden-4-yl]-N-methylmethanimidamide.
| Compound Name | N-ethyl-N'-[7-(2-methoxyanilino)-2,3-dihydro-1H-inden-4-yl]-N-methylmethanimidamide |
|---|---|
| PubChem CID | 150769189 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | N-ethyl-N'-[7-(2-methoxyanilino)-2,3-dihydro-1H-inden-4-yl]-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1ccc(Nc2ccccc2OC)c2c1CCC2 |
| InChI | InChI=1S/C20H25N3O/c1-4-23(2)14-21-17-12-13-18(16-9-7-8-15(16)17)22-19-10-5-6-11-20(19)24-3/h5-6,10-14,22H,4,7-9H2,1-3H3/b21-14+ |
| InChIKey | JZMRYHHMLRVDLB-KGENOOAVSA-N |
| XLogP | 4.54 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|