C18H19ClF3N3O — CID 154647620
N'-[2-chloro-5-methyl-3-[2-(trifluoromethoxy)anilino]phenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 154647620) has the molecular formula C18H19ClF3N3O and a molecular weight of 385.82 g/mol. Its IUPAC name is N'-[2-chloro-5-methyl-3-[2-(trifluoromethoxy)anilino]phenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2-chloro-5-methyl-3-[2-(trifluoromethoxy)anilino]phenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 154647620 |
| Molecular Formula | C18H19ClF3N3O |
| Molecular Weight | 385.82 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | N'-[2-chloro-5-methyl-3-[2-(trifluoromethoxy)anilino]phenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)cc(Nc2ccccc2OC(F)(F)F)c1Cl |
| InChI | InChI=1S/C18H19ClF3N3O/c1-4-25(3)11-23-14-9-12(2)10-15(17(14)19)24-13-7-5-6-8-16(13)26-18(20,21)22/h5-11,24H,4H2,1-3H3/b23-11+ |
| InChIKey | BAHCXXGIYSMRTK-FOKLQQMPSA-N |
| XLogP | 5.90 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.82 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|