C18H22N2O — CID 175763414
N'-[2-[2,5-bis(deuteriomethyl)phenoxy]phenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 175763414) has the molecular formula C18H22N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is N'-[2-[2,5-bis(deuteriomethyl)phenoxy]phenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2-[2,5-bis(deuteriomethyl)phenoxy]phenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 175763414 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | N'-[2-[2,5-bis(deuteriomethyl)phenoxy]phenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | [2H]Cc1ccc(C[2H])c(Oc2ccccc2/N=C\N(C)CC)c1 |
| InChI | InChI=1S/C18H22N2O/c1-5-20(4)13-19-16-8-6-7-9-17(16)21-18-12-14(2)10-11-15(18)3/h6-13H,5H2,1-4H3/b19-13-/i2D,3D |
| InChIKey | IXLRGWAAJBJMSQ-QDASWXFVSA-N |
| XLogP | 4.71 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|