C15H16FN3OS — CID 81060556
4-(3-fluoro-4-methoxyanilino)-2,6-dimethylpyridine-3-carbothioamide (PubChem CID 81060556) has the molecular formula C15H16FN3OS and a molecular weight of 305.38 g/mol. Its IUPAC name is 4-(3-fluoro-4-methoxyanilino)-2,6-dimethylpyridine-3-carbothioamide.
| Compound Name | 4-(3-fluoro-4-methoxyanilino)-2,6-dimethylpyridine-3-carbothioamide |
|---|---|
| PubChem CID | 81060556 |
| Molecular Formula | C15H16FN3OS |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 4-(3-fluoro-4-methoxyanilino)-2,6-dimethylpyridine-3-carbothioamide |
| SMILES | COc1ccc(Nc2cc(C)nc(C)c2C(N)=S)cc1F |
| InChI | InChI=1S/C15H16FN3OS/c1-8-6-12(14(15(17)21)9(2)18-8)19-10-4-5-13(20-3)11(16)7-10/h4-7H,1-3H3,(H2,17,21)(H,18,19) |
| InChIKey | MYCVNTPBYRGADP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|