C18H24FN3O2 — CID 146643808
2-N-ethyl-3-[(3-fluoro-4-methoxyanilino)methyl]-4-methoxy-2-N-methylbenzene-1,2-diamine (PubChem CID 146643808) has the molecular formula C18H24FN3O2 and a molecular weight of 333.41 g/mol. Its IUPAC name is 2-N-ethyl-3-[(3-fluoro-4-methoxyanilino)methyl]-4-methoxy-2-N-methylbenzene-1,2-diamine.
| Compound Name | 2-N-ethyl-3-[(3-fluoro-4-methoxyanilino)methyl]-4-methoxy-2-N-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 146643808 |
| Molecular Formula | C18H24FN3O2 |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 2-N-ethyl-3-[(3-fluoro-4-methoxyanilino)methyl]-4-methoxy-2-N-methylbenzene-1,2-diamine |
| SMILES | CCN(C)c1c(N)ccc(OC)c1CNc1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C18H24FN3O2/c1-5-22(2)18-13(16(23-3)9-7-15(18)20)11-21-12-6-8-17(24-4)14(19)10-12/h6-10,21H,5,11,20H2,1-4H3 |
| InChIKey | USIBMZQPSFIKLT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|