C19H25F2N3O2 — CID 146643005
3-[(3,5-difluoro-4-methoxyanilino)methyl]-2-N,2-N-diethyl-4-methoxybenzene-1,2-diamine (PubChem CID 146643005) has the molecular formula C19H25F2N3O2 and a molecular weight of 365.42 g/mol. Its IUPAC name is 3-[(3,5-difluoro-4-methoxyanilino)methyl]-2-N,2-N-diethyl-4-methoxybenzene-1,2-diamine.
| Compound Name | 3-[(3,5-difluoro-4-methoxyanilino)methyl]-2-N,2-N-diethyl-4-methoxybenzene-1,2-diamine |
|---|---|
| PubChem CID | 146643005 |
| Molecular Formula | C19H25F2N3O2 |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 3-[(3,5-difluoro-4-methoxyanilino)methyl]-2-N,2-N-diethyl-4-methoxybenzene-1,2-diamine |
| SMILES | CCN(CC)c1c(N)ccc(OC)c1CNc1cc(F)c(OC)c(F)c1 |
| InChI | InChI=1S/C19H25F2N3O2/c1-5-24(6-2)18-13(17(25-3)8-7-16(18)22)11-23-12-9-14(20)19(26-4)15(21)10-12/h7-10,23H,5-6,11,22H2,1-4H3 |
| InChIKey | WZVXLYKWPZJPGO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|