C16H16F2N4O3 — CID 146642838
N-[(3-amino-2-diazenyl-6-methoxyphenyl)methyl]-3,5-difluoro-4-methoxybenzamide (PubChem CID 146642838) has the molecular formula C16H16F2N4O3 and a molecular weight of 350.33 g/mol. Its IUPAC name is N-[(3-amino-2-diazenyl-6-methoxyphenyl)methyl]-3,5-difluoro-4-methoxybenzamide.
| Compound Name | N-[(3-amino-2-diazenyl-6-methoxyphenyl)methyl]-3,5-difluoro-4-methoxybenzamide |
|---|---|
| PubChem CID | 146642838 |
| Molecular Formula | C16H16F2N4O3 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | N-[(3-amino-2-diazenyl-6-methoxyphenyl)methyl]-3,5-difluoro-4-methoxybenzamide |
| SMILES | [H]/N=N/c1c(N)ccc(OC)c1CNC(=O)c1cc(F)c(OC)c(F)c1 |
| InChI | InChI=1S/C16H16F2N4O3/c1-24-13-4-3-12(19)14(22-20)9(13)7-21-16(23)8-5-10(17)15(25-2)11(18)6-8/h3-6,20H,7,19H2,1-2H3,(H,21,23)/b22-20+ |
| InChIKey | GZSPSFQLMDYOTN-LSDHQDQOSA-N |
| XLogP | 3.16 |
| TPSA | 109.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|