C17H19F3N4O3 — CID 146643476
N-[[3-amino-6-methoxy-2-(2-methylhydrazinyl)phenyl]methyl]-4-(trifluoromethoxy)benzamide (PubChem CID 146643476) has the molecular formula C17H19F3N4O3 and a molecular weight of 384.36 g/mol. Its IUPAC name is N-[[3-amino-6-methoxy-2-(2-methylhydrazinyl)phenyl]methyl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[[3-amino-6-methoxy-2-(2-methylhydrazinyl)phenyl]methyl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 146643476 |
| Molecular Formula | C17H19F3N4O3 |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | N-[[3-amino-6-methoxy-2-(2-methylhydrazinyl)phenyl]methyl]-4-(trifluoromethoxy)benzamide |
| SMILES | CNNc1c(N)ccc(OC)c1CNC(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H19F3N4O3/c1-22-24-15-12(14(26-2)8-7-13(15)21)9-23-16(25)10-3-5-11(6-4-10)27-17(18,19)20/h3-8,22,24H,9,21H2,1-2H3,(H,23,25) |
| InChIKey | JLOKXAFANNWGOA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|