C13H9BrF3NO2S — CID 115598108
N-[(3-bromothiophen-2-yl)methyl]-4-(trifluoromethoxy)benzamide (PubChem CID 115598108) has the molecular formula C13H9BrF3NO2S and a molecular weight of 380.19 g/mol. Its IUPAC name is N-[(3-bromothiophen-2-yl)methyl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[(3-bromothiophen-2-yl)methyl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 115598108 |
| Molecular Formula | C13H9BrF3NO2S |
| Molecular Weight | 380.19 g/mol |
| Exact Mass | 378.95 |
| IUPAC Name | N-[(3-bromothiophen-2-yl)methyl]-4-(trifluoromethoxy)benzamide |
| SMILES | O=C(NCc1sccc1Br)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H9BrF3NO2S/c14-10-5-6-21-11(10)7-18-12(19)8-1-3-9(4-2-8)20-13(15,16)17/h1-6H,7H2,(H,18,19) |
| InChIKey | JDDUQNLHSYWVIZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.19 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |