C10H11BrF3NO2S — CID 113228461
N-[(3-bromothiophen-2-yl)methyl]-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 113228461) has the molecular formula C10H11BrF3NO2S and a molecular weight of 346.17 g/mol. Its IUPAC name is N-[(3-bromothiophen-2-yl)methyl]-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-[(3-bromothiophen-2-yl)methyl]-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 113228461 |
| Molecular Formula | C10H11BrF3NO2S |
| Molecular Weight | 346.17 g/mol |
| Exact Mass | 344.96 |
| IUPAC Name | N-[(3-bromothiophen-2-yl)methyl]-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | O=C(CCOCC(F)(F)F)NCc1sccc1Br |
| InChI | InChI=1S/C10H11BrF3NO2S/c11-7-2-4-18-8(7)5-15-9(16)1-3-17-6-10(12,13)14/h2,4H,1,3,5-6H2,(H,15,16) |
| InChIKey | AHYJGVIDOWIUBZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.17 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|