C10H15BrN2O2S — CID 103156291
4-amino-N-[(3-bromothiophen-2-yl)methyl]-3-methoxybutanamide (PubChem CID 103156291) has the molecular formula C10H15BrN2O2S and a molecular weight of 307.21 g/mol. Its IUPAC name is 4-amino-N-[(3-bromothiophen-2-yl)methyl]-3-methoxybutanamide.
| Compound Name | 4-amino-N-[(3-bromothiophen-2-yl)methyl]-3-methoxybutanamide |
|---|---|
| PubChem CID | 103156291 |
| Molecular Formula | C10H15BrN2O2S |
| Molecular Weight | 307.21 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | 4-amino-N-[(3-bromothiophen-2-yl)methyl]-3-methoxybutanamide |
| SMILES | COC(CN)CC(=O)NCc1sccc1Br |
| InChI | InChI=1S/C10H15BrN2O2S/c1-15-7(5-12)4-10(14)13-6-9-8(11)2-3-16-9/h2-3,7H,4-6,12H2,1H3,(H,13,14) |
| InChIKey | UEMVINKAIRTCKM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.21 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |