C9H14BrClN2O2S — CID 120987993
2-amino-N-[(3-bromothiophen-2-yl)methyl]-3-methoxypropanamide;hydrochloride (PubChem CID 120987993) has the molecular formula C9H14BrClN2O2S and a molecular weight of 329.65 g/mol. Its IUPAC name is 2-amino-N-[(3-bromothiophen-2-yl)methyl]-3-methoxypropanamide;hydrochloride.
| Compound Name | 2-amino-N-[(3-bromothiophen-2-yl)methyl]-3-methoxypropanamide;hydrochloride |
|---|---|
| PubChem CID | 120987993 |
| Molecular Formula | C9H14BrClN2O2S |
| Molecular Weight | 329.65 g/mol |
| Exact Mass | 327.96 |
| IUPAC Name | 2-amino-N-[(3-bromothiophen-2-yl)methyl]-3-methoxypropanamide;hydrochloride |
| SMILES | COCC(N)C(=O)NCc1sccc1Br.Cl |
| InChI | InChI=1S/C9H13BrN2O2S.ClH/c1-14-5-7(11)9(13)12-4-8-6(10)2-3-15-8;/h2-3,7H,4-5,11H2,1H3,(H,12,13);1H |
| InChIKey | YETVSGAFEIBJRI-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.65 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |