C10H12BrNOS — CID 78986047
N-[(3-bromothiophen-2-yl)methyl]-3-methylbut-2-enamide (PubChem CID 78986047) has the molecular formula C10H12BrNOS and a molecular weight of 274.18 g/mol. Its IUPAC name is N-[(3-bromothiophen-2-yl)methyl]-3-methylbut-2-enamide.
| Compound Name | N-[(3-bromothiophen-2-yl)methyl]-3-methylbut-2-enamide |
|---|---|
| PubChem CID | 78986047 |
| Molecular Formula | C10H12BrNOS |
| Molecular Weight | 274.18 g/mol |
| Exact Mass | 272.98 |
| IUPAC Name | N-[(3-bromothiophen-2-yl)methyl]-3-methylbut-2-enamide |
| SMILES | CC(C)=CC(=O)NCc1sccc1Br |
| InChI | InChI=1S/C10H12BrNOS/c1-7(2)5-10(13)12-6-9-8(11)3-4-14-9/h3-5H,6H2,1-2H3,(H,12,13) |
| InChIKey | AMDMHLWWEPITCF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.18 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|