C10H15BrN2OS — CID 78986182
3-[(3-bromothiophen-2-yl)methyl]-1,1-diethylurea (PubChem CID 78986182) has the molecular formula C10H15BrN2OS and a molecular weight of 291.21 g/mol. Its IUPAC name is 3-[(3-bromothiophen-2-yl)methyl]-1,1-diethylurea.
| Compound Name | 3-[(3-bromothiophen-2-yl)methyl]-1,1-diethylurea |
|---|---|
| PubChem CID | 78986182 |
| Molecular Formula | C10H15BrN2OS |
| Molecular Weight | 291.21 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 3-[(3-bromothiophen-2-yl)methyl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NCc1sccc1Br |
| InChI | InChI=1S/C10H15BrN2OS/c1-3-13(4-2)10(14)12-7-9-8(11)5-6-15-9/h5-6H,3-4,7H2,1-2H3,(H,12,14) |
| InChIKey | UVDLDFLJBADQHI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.21 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |