C12H19BrN2OS — CID 115380150
3-[(3-bromothiophen-2-yl)methylamino]-N,N-diethylpropanamide (PubChem CID 115380150) has the molecular formula C12H19BrN2OS and a molecular weight of 319.27 g/mol. Its IUPAC name is 3-[(3-bromothiophen-2-yl)methylamino]-N,N-diethylpropanamide.
| Compound Name | 3-[(3-bromothiophen-2-yl)methylamino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 115380150 |
| Molecular Formula | C12H19BrN2OS |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 3-[(3-bromothiophen-2-yl)methylamino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCNCc1sccc1Br |
| InChI | InChI=1S/C12H19BrN2OS/c1-3-15(4-2)12(16)5-7-14-9-11-10(13)6-8-17-11/h6,8,14H,3-5,7,9H2,1-2H3 |
| InChIKey | SKORASSJQWENMO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|