C10H16BrNOS — CID 107267901
5-[(3-bromothiophen-2-yl)methylamino]pentan-2-ol (PubChem CID 107267901) has the molecular formula C10H16BrNOS and a molecular weight of 278.21 g/mol. Its IUPAC name is 5-[(3-bromothiophen-2-yl)methylamino]pentan-2-ol.
| Compound Name | 5-[(3-bromothiophen-2-yl)methylamino]pentan-2-ol |
|---|---|
| PubChem CID | 107267901 |
| Molecular Formula | C10H16BrNOS |
| Molecular Weight | 278.21 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 5-[(3-bromothiophen-2-yl)methylamino]pentan-2-ol |
| SMILES | CC(O)CCCNCc1sccc1Br |
| InChI | InChI=1S/C10H16BrNOS/c1-8(13)3-2-5-12-7-10-9(11)4-6-14-10/h4,6,8,12-13H,2-3,5,7H2,1H3 |
| InChIKey | XXPKKYITACCMFC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.21 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|