C10H13BrN4S — CID 115380238
N-[(3-bromothiophen-2-yl)methyl]-3-(1H-1,2,4-triazol-5-yl)propan-1-amine (PubChem CID 115380238) has the molecular formula C10H13BrN4S and a molecular weight of 301.21 g/mol. Its IUPAC name is N-[(3-bromothiophen-2-yl)methyl]-3-(1H-1,2,4-triazol-5-yl)propan-1-amine.
| Compound Name | N-[(3-bromothiophen-2-yl)methyl]-3-(1H-1,2,4-triazol-5-yl)propan-1-amine |
|---|---|
| PubChem CID | 115380238 |
| Molecular Formula | C10H13BrN4S |
| Molecular Weight | 301.21 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | N-[(3-bromothiophen-2-yl)methyl]-3-(1H-1,2,4-triazol-5-yl)propan-1-amine |
| SMILES | Brc1ccsc1CNCCCc1ncn[nH]1 |
| InChI | InChI=1S/C10H13BrN4S/c11-8-3-5-16-9(8)6-12-4-1-2-10-13-7-14-15-10/h3,5,7,12H,1-2,4,6H2,(H,13,14,15) |
| InChIKey | POONQGMHHYUMEP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.21 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|