C11H19BrN2OS — CID 103080825
N-[(3-bromothiophen-2-yl)methyl]-2-[2-(dimethylamino)ethoxy]ethanamine (PubChem CID 103080825) has the molecular formula C11H19BrN2OS and a molecular weight of 307.26 g/mol. Its IUPAC name is N-[(3-bromothiophen-2-yl)methyl]-2-[2-(dimethylamino)ethoxy]ethanamine.
| Compound Name | N-[(3-bromothiophen-2-yl)methyl]-2-[2-(dimethylamino)ethoxy]ethanamine |
|---|---|
| PubChem CID | 103080825 |
| Molecular Formula | C11H19BrN2OS |
| Molecular Weight | 307.26 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | N-[(3-bromothiophen-2-yl)methyl]-2-[2-(dimethylamino)ethoxy]ethanamine |
| SMILES | CN(C)CCOCCNCc1sccc1Br |
| InChI | InChI=1S/C11H19BrN2OS/c1-14(2)5-7-15-6-4-13-9-11-10(12)3-8-16-11/h3,8,13H,4-7,9H2,1-2H3 |
| InChIKey | SJBXNGUHCXMCAR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|