C15H25BrN2O3 — CID 103080764
N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2-[2-(dimethylamino)ethoxy]ethanamine (PubChem CID 103080764) has the molecular formula C15H25BrN2O3 and a molecular weight of 361.28 g/mol. Its IUPAC name is N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2-[2-(dimethylamino)ethoxy]ethanamine.
| Compound Name | N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2-[2-(dimethylamino)ethoxy]ethanamine |
|---|---|
| PubChem CID | 103080764 |
| Molecular Formula | C15H25BrN2O3 |
| Molecular Weight | 361.28 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2-[2-(dimethylamino)ethoxy]ethanamine |
| SMILES | COc1cc(CNCCOCCN(C)C)cc(Br)c1OC |
| InChI | InChI=1S/C15H25BrN2O3/c1-18(2)6-8-21-7-5-17-11-12-9-13(16)15(20-4)14(10-12)19-3/h9-10,17H,5-8,11H2,1-4H3 |
| InChIKey | UUKUJRWXKZYSAJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|