C12H10BrFN2OS — CID 78983654
1-[(3-bromothiophen-2-yl)methyl]-3-(4-fluorophenyl)urea (PubChem CID 78983654) has the molecular formula C12H10BrFN2OS and a molecular weight of 329.19 g/mol. Its IUPAC name is 1-[(3-bromothiophen-2-yl)methyl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[(3-bromothiophen-2-yl)methyl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 78983654 |
| Molecular Formula | C12H10BrFN2OS |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 327.97 |
| IUPAC Name | 1-[(3-bromothiophen-2-yl)methyl]-3-(4-fluorophenyl)urea |
| SMILES | O=C(NCc1sccc1Br)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C12H10BrFN2OS/c13-10-5-6-18-11(10)7-15-12(17)16-9-3-1-8(14)2-4-9/h1-6H,7H2,(H2,15,16,17) |
| InChIKey | VTFRZTKLCVYZTR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |