C12H16FN3O — CID 113313693
1-[[1-(aminomethyl)cyclopropyl]methyl]-3-(4-fluorophenyl)urea (PubChem CID 113313693) has the molecular formula C12H16FN3O and a molecular weight of 237.28 g/mol. Its IUPAC name is 1-[[1-(aminomethyl)cyclopropyl]methyl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[[1-(aminomethyl)cyclopropyl]methyl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 113313693 |
| Molecular Formula | C12H16FN3O |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 1-[[1-(aminomethyl)cyclopropyl]methyl]-3-(4-fluorophenyl)urea |
| SMILES | NCC1(CNC(=O)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C12H16FN3O/c13-9-1-3-10(4-2-9)16-11(17)15-8-12(7-14)5-6-12/h1-4H,5-8,14H2,(H2,15,16,17) |
| InChIKey | HTKZWGXRKCYYNS-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |