C18H16FN3O — CID 113214424
1-(4-cyanophenyl)-3-[[1-(4-fluorophenyl)cyclopropyl]methyl]urea (PubChem CID 113214424) has the molecular formula C18H16FN3O and a molecular weight of 309.34 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-3-[[1-(4-fluorophenyl)cyclopropyl]methyl]urea.
| Compound Name | 1-(4-cyanophenyl)-3-[[1-(4-fluorophenyl)cyclopropyl]methyl]urea |
|---|---|
| PubChem CID | 113214424 |
| Molecular Formula | C18H16FN3O |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 1-(4-cyanophenyl)-3-[[1-(4-fluorophenyl)cyclopropyl]methyl]urea |
| SMILES | N#Cc1ccc(NC(=O)NCC2(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C18H16FN3O/c19-15-5-3-14(4-6-15)18(9-10-18)12-21-17(23)22-16-7-1-13(11-20)2-8-16/h1-8H,9-10,12H2,(H2,21,22,23) |
| InChIKey | YMEPUJAMTZODDK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |