C24H23FN2O2 — CID 113214398
1-[[1-(4-fluorophenyl)cyclopropyl]methyl]-3-(4-phenylmethoxyphenyl)urea (PubChem CID 113214398) has the molecular formula C24H23FN2O2 and a molecular weight of 390.46 g/mol. Its IUPAC name is 1-[[1-(4-fluorophenyl)cyclopropyl]methyl]-3-(4-phenylmethoxyphenyl)urea.
| Compound Name | 1-[[1-(4-fluorophenyl)cyclopropyl]methyl]-3-(4-phenylmethoxyphenyl)urea |
|---|---|
| PubChem CID | 113214398 |
| Molecular Formula | C24H23FN2O2 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 1-[[1-(4-fluorophenyl)cyclopropyl]methyl]-3-(4-phenylmethoxyphenyl)urea |
| SMILES | O=C(NCC1(c2ccc(F)cc2)CC1)Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H23FN2O2/c25-20-8-6-19(7-9-20)24(14-15-24)17-26-23(28)27-21-10-12-22(13-11-21)29-16-18-4-2-1-3-5-18/h1-13H,14-17H2,(H2,26,27,28) |
| InChIKey | VRUIINNXZCLOPQ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |