C24H24N2O2 — CID 113215329
1-[1-(4-methylphenyl)cyclopropyl]-3-(4-phenylmethoxyphenyl)urea (PubChem CID 113215329) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 1-[1-(4-methylphenyl)cyclopropyl]-3-(4-phenylmethoxyphenyl)urea.
| Compound Name | 1-[1-(4-methylphenyl)cyclopropyl]-3-(4-phenylmethoxyphenyl)urea |
|---|---|
| PubChem CID | 113215329 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 1-[1-(4-methylphenyl)cyclopropyl]-3-(4-phenylmethoxyphenyl)urea |
| SMILES | Cc1ccc(C2(NC(=O)Nc3ccc(OCc4ccccc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H24N2O2/c1-18-7-9-20(10-8-18)24(15-16-24)26-23(27)25-21-11-13-22(14-12-21)28-17-19-5-3-2-4-6-19/h2-14H,15-17H2,1H3,(H2,25,26,27) |
| InChIKey | NNMZMHOOSWHGRS-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |