C20H21FN2O2 — CID 42335602
N'-(4-ethylphenyl)-N-[[1-(4-fluorophenyl)cyclopropyl]methyl]oxamide (PubChem CID 42335602) has the molecular formula C20H21FN2O2 and a molecular weight of 340.40 g/mol. Its IUPAC name is N'-(4-ethylphenyl)-N-[[1-(4-fluorophenyl)cyclopropyl]methyl]oxamide.
| Compound Name | N'-(4-ethylphenyl)-N-[[1-(4-fluorophenyl)cyclopropyl]methyl]oxamide |
|---|---|
| PubChem CID | 42335602 |
| Molecular Formula | C20H21FN2O2 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | N'-(4-ethylphenyl)-N-[[1-(4-fluorophenyl)cyclopropyl]methyl]oxamide |
| SMILES | CCc1ccc(NC(=O)C(=O)NCC2(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H21FN2O2/c1-2-14-3-9-17(10-4-14)23-19(25)18(24)22-13-20(11-12-20)15-5-7-16(21)8-6-15/h3-10H,2,11-13H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | RQRLEMOJJHFLCK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|