C14H22BrNOS — CID 78985808
N-[(3-bromothiophen-2-yl)methyl]-3,5,5-trimethylhexanamide (PubChem CID 78985808) has the molecular formula C14H22BrNOS and a molecular weight of 332.31 g/mol. Its IUPAC name is N-[(3-bromothiophen-2-yl)methyl]-3,5,5-trimethylhexanamide.
| Compound Name | N-[(3-bromothiophen-2-yl)methyl]-3,5,5-trimethylhexanamide |
|---|---|
| PubChem CID | 78985808 |
| Molecular Formula | C14H22BrNOS |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N-[(3-bromothiophen-2-yl)methyl]-3,5,5-trimethylhexanamide |
| SMILES | CC(CC(=O)NCc1sccc1Br)CC(C)(C)C |
| InChI | InChI=1S/C14H22BrNOS/c1-10(8-14(2,3)4)7-13(17)16-9-12-11(15)5-6-18-12/h5-6,10H,7-9H2,1-4H3,(H,16,17) |
| InChIKey | RAZXYCPMYUJAPF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |