C10H14BrNO2S — CID 78952228
methyl 2-[(3-bromothiophen-2-yl)methylamino]-2-methylpropanoate (PubChem CID 78952228) has the molecular formula C10H14BrNO2S and a molecular weight of 292.20 g/mol. Its IUPAC name is methyl 2-[(3-bromothiophen-2-yl)methylamino]-2-methylpropanoate.
| Compound Name | methyl 2-[(3-bromothiophen-2-yl)methylamino]-2-methylpropanoate |
|---|---|
| PubChem CID | 78952228 |
| Molecular Formula | C10H14BrNO2S |
| Molecular Weight | 292.20 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | methyl 2-[(3-bromothiophen-2-yl)methylamino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)NCc1sccc1Br |
| InChI | InChI=1S/C10H14BrNO2S/c1-10(2,9(13)14-3)12-6-8-7(11)4-5-15-8/h4-5,12H,6H2,1-3H3 |
| InChIKey | PBFDYHBLNWVFDT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.20 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |