C18H25FN2O — CID 163372419
N'-[4-(2-cyclopentylacetyl)-5-fluoro-2-methylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 163372419) has the molecular formula C18H25FN2O and a molecular weight of 304.41 g/mol. Its IUPAC name is N'-[4-(2-cyclopentylacetyl)-5-fluoro-2-methylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[4-(2-cyclopentylacetyl)-5-fluoro-2-methylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 163372419 |
| Molecular Formula | C18H25FN2O |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | N'-[4-(2-cyclopentylacetyl)-5-fluoro-2-methylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(F)c(C(=O)CC2CCCC2)cc1C |
| InChI | InChI=1S/C18H25FN2O/c1-4-21(3)12-20-17-11-16(19)15(9-13(17)2)18(22)10-14-7-5-6-8-14/h9,11-12,14H,4-8,10H2,1-3H3/b20-12+ |
| InChIKey | HDAHVYMBYGMVKL-UDWIEESQSA-N |
| XLogP | 4.51 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|