C21H32N2O — CID 163372388
N'-[4-(2-cyclopentylacetyl)-2,5-dimethylphenyl]-N-ethyl-N-methylpropanimidamide (PubChem CID 163372388) has the molecular formula C21H32N2O and a molecular weight of 328.50 g/mol. Its IUPAC name is N'-[4-(2-cyclopentylacetyl)-2,5-dimethylphenyl]-N-ethyl-N-methylpropanimidamide.
| Compound Name | N'-[4-(2-cyclopentylacetyl)-2,5-dimethylphenyl]-N-ethyl-N-methylpropanimidamide |
|---|---|
| PubChem CID | 163372388 |
| Molecular Formula | C21H32N2O |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | N'-[4-(2-cyclopentylacetyl)-2,5-dimethylphenyl]-N-ethyl-N-methylpropanimidamide |
| SMILES | CC/C(=N\c1cc(C)c(C(=O)CC2CCCC2)cc1C)N(C)CC |
| InChI | InChI=1S/C21H32N2O/c1-6-21(23(5)7-2)22-19-13-15(3)18(12-16(19)4)20(24)14-17-10-8-9-11-17/h12-13,17H,6-11,14H2,1-5H3/b22-21+ |
| InChIKey | CJNKLBUQIIYAPN-QURGRASLSA-N |
| XLogP | 5.46 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|